C25H43N3O2Si — CID 101498061
(3R,5R,6R,7S)-N-tert-butyl-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-phenylethyl)-1,4-diazabicyclo[4.1.0]heptane-5-carboxamide (PubChem CID 101498061) has the molecular formula C25H43N3O2Si and a molecular weight of 445.72 g/mol. Its IUPAC name is (3R,5R,6R,7S)-N-tert-butyl-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-phenylethyl)-1,4-diazabicyclo[4.1.0]heptane-5-carboxamide.
| Compound Name | (3R,5R,6R,7S)-N-tert-butyl-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-phenylethyl)-1,4-diazabicyclo[4.1.0]heptane-5-carboxamide |
|---|---|
| PubChem CID | 101498061 |
| Molecular Formula | C25H43N3O2Si |
| Molecular Weight | 445.72 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | (3R,5R,6R,7S)-N-tert-butyl-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-phenylethyl)-1,4-diazabicyclo[4.1.0]heptane-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1N[C@H](CCc2ccccc2)CN2[C@H]1[C@H]2CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H43N3O2Si/c1-24(2,3)27-23(29)21-22-20(17-30-31(7,8)25(4,5)6)28(22)16-19(26-21)15-14-18-12-10-9-11-13-18/h9-13,19-22,26H,14-17H2,1-8H3,(H,27,29)/t19-,20-,21-,22+,28?/m1/s1 |
| InChIKey | OGDKYVJMLXLKIH-JUQVZKFPSA-N |
| XLogP | 3.95 |
| TPSA | 53.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|