C34H35F5N4S3 — CID 101498219
4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]-3,4-dihydropyrazol-5-yl]benzonitrile (PubChem CID 101498219) has the molecular formula C34H35F5N4S3 and a molecular weight of 690.87 g/mol. Its IUPAC name is 4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]-3,4-dihydropyrazol-5-yl]benzonitrile.
| Compound Name | 4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]-3,4-dihydropyrazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 101498219 |
| Molecular Formula | C34H35F5N4S3 |
| Molecular Weight | 690.87 g/mol |
| Exact Mass | 690.19 |
| IUPAC Name | 4-[(3S)-2-(2,3,4,5,6-pentafluorophenyl)-3-[4-(1,5,9-trithia-13-azacyclohexadec-13-yl)phenyl]-3,4-dihydropyrazol-5-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2=NN(c3c(F)c(F)c(F)c(F)c3F)[C@H](c3ccc(N4CCCSCCCSCCCSCCC4)cc3)C2)cc1 |
| InChI | InChI=1S/C34H35F5N4S3/c35-29-30(36)32(38)34(33(39)31(29)37)43-28(21-27(41-43)24-7-5-23(22-40)6-8-24)25-9-11-26(12-10-25)42-13-1-15-44-17-3-19-46-20-4-18-45-16-2-14-42/h5-12,28H,1-4,13-21H2/t28-/m0/s1 |
| InChIKey | NOHRASUKURZNCV-NDEPHWFRSA-N |
| XLogP | 9.19 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.87 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|