C14H21N6O2+ — CID 101498433
1-methyl-6-(4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-en-10-yl)pyrimidine-2,4-dione (PubChem CID 101498433) has the molecular formula C14H21N6O2+ and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-methyl-6-(4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-en-10-yl)pyrimidine-2,4-dione.
| Compound Name | 1-methyl-6-(4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-en-10-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101498433 |
| Molecular Formula | C14H21N6O2+ |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-methyl-6-(4,7,10-triaza-1-azoniatricyclo[5.5.1.04,13]tridec-1(13)-en-10-yl)pyrimidine-2,4-dione |
| SMILES | Cn1c(N2CCN3CCN4CC[N+](=C34)CC2)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C14H20N6O2/c1-16-12(10-11(21)15-13(16)22)17-2-4-18-6-8-20-9-7-19(5-3-17)14(18)20/h10H,2-9H2,1H3/p+1 |
| InChIKey | FJKWQPFRSRIFMU-UHFFFAOYSA-O |
| XLogP | -2.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|