C44H43N5O8 — CID 101498691
2-[[2-[[(2S)-2-[[2-[[(2S)-3-(4-hydroxyphenyl)-2-(4-pyren-1-ylbutanoylamino)propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid (PubChem CID 101498691) has the molecular formula C44H43N5O8 and a molecular weight of 769.86 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-[[2-[[(2S)-3-(4-hydroxyphenyl)-2-(4-pyren-1-ylbutanoylamino)propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(2S)-2-[[2-[[(2S)-3-(4-hydroxyphenyl)-2-(4-pyren-1-ylbutanoylamino)propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 101498691 |
| Molecular Formula | C44H43N5O8 |
| Molecular Weight | 769.86 g/mol |
| Exact Mass | 769.31 |
| IUPAC Name | 2-[[2-[[(2S)-2-[[2-[[(2S)-3-(4-hydroxyphenyl)-2-(4-pyren-1-ylbutanoylamino)propanoyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C44H43N5O8/c50-33-19-12-28(13-20-33)23-35(48-37(51)11-5-8-29-14-15-32-17-16-30-9-4-10-31-18-21-34(29)42(32)41(30)31)43(56)47-25-39(53)49-36(22-27-6-2-1-3-7-27)44(57)46-24-38(52)45-26-40(54)55/h1-4,6-7,9-10,12-21,35-36,50H,5,8,11,22-26H2,(H,45,52)(H,46,57)(H,47,56)(H,48,51)(H,49,53)(H,54,55)/t35-,36-/m0/s1 |
| InChIKey | VTTPGSLAZVKZQN-ZPGRZCPFSA-N |
| XLogP | 3.50 |
| TPSA | 203.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|