About [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate
[1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate (PubChem CID 101499110) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate.
Molecular Properties
| Compound Name | [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate |
| PubChem CID | 101499110 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate |
| SMILES | C=CCCCC(OC(C)=O)C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C17H23NO3/c1-5-6-7-11-15(21-14(4)19)17(20)18-16-12(2)9-8-10-13(16)3/h5,8-10,15H,1,6-7,11H2,2-4H3,(H,18,20) |
| InChIKey | OICQJEPDYSBGPZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate?
The IUPAC name of [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate (CID 101499110) is [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate.
What is the SMILES notation for [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate?
The canonical SMILES for [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate is C=CCCCC(OC(C)=O)C(=O)Nc1c(C)cccc1C.
What is the InChIKey of [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate?
The InChIKey is OICQJEPDYSBGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-5-6-7-11-15(21-14(4)19)17(20)18-16-12(2)9-8-10-13(16)3/h5,8-10,15H,1,6-7,11H2,2-4H3,(H,18,20).
What are the key properties of [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate?
[1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate has a molecular weight of 289.38 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,6-dimethylanilino)-1-oxohept-6-en-2-yl] acetate is sourced from PubChem (CID 101499110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).