C15H32NO5P — CID 10149938
[(E,2S,3S)-2-amino-3-hydroxypentadec-4-enyl] dihydrogen phosphate (PubChem CID 10149938) has the molecular formula C15H32NO5P and a molecular weight of 337.40 g/mol. Its IUPAC name is [(E,2S,3S)-2-amino-3-hydroxypentadec-4-enyl] dihydrogen phosphate.
| Compound Name | [(E,2S,3S)-2-amino-3-hydroxypentadec-4-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10149938 |
| Molecular Formula | C15H32NO5P |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [(E,2S,3S)-2-amino-3-hydroxypentadec-4-enyl] dihydrogen phosphate |
| SMILES | CCCCCCCCCC/C=C/[C@H](O)[C@@H](N)COP(=O)(O)O |
| InChI | InChI=1S/C15H32NO5P/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)14(16)13-21-22(18,19)20/h11-12,14-15,17H,2-10,13,16H2,1H3,(H2,18,19,20)/b12-11+/t14-,15-/m0/s1 |
| InChIKey | LDACFZBJXUAJHJ-NOQIOLJMSA-N |
| XLogP | 2.87 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|