About [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate
[(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate (PubChem CID 101499971) has the molecular formula C17H26O2
and a molecular weight of 262.39 g/mol. Its IUPAC name is [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate.
Molecular Properties
| Compound Name | [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate |
| PubChem CID | 101499971 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate |
| SMILES | C=CC(=C)CC/C=C(/CCC=C(C)C)COC(C)=O |
| InChI | InChI=1S/C17H26O2/c1-6-15(4)10-8-12-17(13-19-16(5)18)11-7-9-14(2)3/h6,9,12H,1,4,7-8,10-11,13H2,2-3,5H3/b17-12- |
| InChIKey | GEYNKZNUVHPUPN-ATVHPVEESA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate?
The IUPAC name of [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate (CID 101499971) is [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate.
What is the SMILES notation for [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate?
The canonical SMILES for [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate is C=CC(=C)CC/C=C(/CCC=C(C)C)COC(C)=O.
What is the InChIKey of [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate?
The InChIKey is GEYNKZNUVHPUPN-ATVHPVEESA-N. The full InChI is InChI=1S/C17H26O2/c1-6-15(4)10-8-12-17(13-19-16(5)18)11-7-9-14(2)3/h6,9,12H,1,4,7-8,10-11,13H2,2-3,5H3/b17-12-.
What are the key properties of [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate?
[(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate has a molecular weight of 262.39 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate is sourced from PubChem (CID 101499971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).