C18H17F3N4 — CID 10150032
N'-[7-[3-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10150032) has the molecular formula C18H17F3N4 and a molecular weight of 346.36 g/mol. Its IUPAC name is N'-[7-[3-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[7-[3-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10150032 |
| Molecular Formula | C18H17F3N4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N'-[7-[3-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | NCCCNc1nc(-c2cccc(C(F)(F)F)c2)cc2ncccc12 |
| InChI | InChI=1S/C18H17F3N4/c19-18(20,21)13-5-1-4-12(10-13)15-11-16-14(6-2-8-23-16)17(25-15)24-9-3-7-22/h1-2,4-6,8,10-11H,3,7,9,22H2,(H,24,25) |
| InChIKey | VZYNYQLCAKUWRO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|