C21H25NO4 — CID 10150152
[(1R,4bS,8aR,10aR)-6-cyano-4b,8,8,10a-tetramethyl-3,7-dioxo-2,8a,9,10-tetrahydro-1H-phenanthren-1-yl] acetate (PubChem CID 10150152) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [(1R,4bS,8aR,10aR)-6-cyano-4b,8,8,10a-tetramethyl-3,7-dioxo-2,8a,9,10-tetrahydro-1H-phenanthren-1-yl] acetate.
| Compound Name | [(1R,4bS,8aR,10aR)-6-cyano-4b,8,8,10a-tetramethyl-3,7-dioxo-2,8a,9,10-tetrahydro-1H-phenanthren-1-yl] acetate |
|---|---|
| PubChem CID | 10150152 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(1R,4bS,8aR,10aR)-6-cyano-4b,8,8,10a-tetramethyl-3,7-dioxo-2,8a,9,10-tetrahydro-1H-phenanthren-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(=O)C=C2[C@@]3(C)C=C(C#N)C(=O)C(C)(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C21H25NO4/c1-12(23)26-17-9-14(24)8-16-20(17,4)7-6-15-19(2,3)18(25)13(11-22)10-21(15,16)5/h8,10,15,17H,6-7,9H2,1-5H3/t15-,17+,20+,21-/m0/s1 |
| InChIKey | RYZOLVCMMQIPNG-IAECCPNBSA-N |
| XLogP | 3.30 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |