About 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide
5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide (PubChem CID 10150361) has the molecular formula C18H18N4O3S
and a molecular weight of 370.43 g/mol. Its IUPAC name is 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide |
| PubChem CID | 10150361 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NN3C=c4cnoc4=CC3)cccc12 |
| InChI | InChI=1S/C18H18N4O3S/c1-21(2)16-7-3-6-15-14(16)5-4-8-18(15)26(23,24)20-22-10-9-17-13(12-22)11-19-25-17/h3-9,11-12,20H,10H2,1-2H3 |
| InChIKey | KPZFSAXFIHRWLZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide?
The IUPAC name of 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide (CID 10150361) is 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide.
What is the SMILES notation for 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide?
The canonical SMILES for 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide is CN(C)c1cccc2c(S(=O)(=O)NN3C=c4cnoc4=CC3)cccc12.
What is the InChIKey of 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide?
The InChIKey is KPZFSAXFIHRWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3S/c1-21(2)16-7-3-6-15-14(16)5-4-8-18(15)26(23,24)20-22-10-9-17-13(12-22)11-19-25-17/h3-9,11-12,20H,10H2,1-2H3.
What are the key properties of 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide?
5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide has a molecular weight of 370.43 g/mol, XLogP of 0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-N-(6H-[1,2]oxazolo[4,5-c]pyridin-5-yl)naphthalene-1-sulfonamide is sourced from PubChem (CID 10150361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).