C19H19BrO3 — CID 10150414
6-[1-[4-(4-bromophenyl)phenyl]ethenyl]-3,3-dimethyl-1,2,4-trioxane (PubChem CID 10150414) has the molecular formula C19H19BrO3 and a molecular weight of 375.26 g/mol. Its IUPAC name is 6-[1-[4-(4-bromophenyl)phenyl]ethenyl]-3,3-dimethyl-1,2,4-trioxane.
| Compound Name | 6-[1-[4-(4-bromophenyl)phenyl]ethenyl]-3,3-dimethyl-1,2,4-trioxane |
|---|---|
| PubChem CID | 10150414 |
| Molecular Formula | C19H19BrO3 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 6-[1-[4-(4-bromophenyl)phenyl]ethenyl]-3,3-dimethyl-1,2,4-trioxane |
| SMILES | C=C(c1ccc(-c2ccc(Br)cc2)cc1)C1COC(C)(C)OO1 |
| InChI | InChI=1S/C19H19BrO3/c1-13(18-12-21-19(2,3)23-22-18)14-4-6-15(7-5-14)16-8-10-17(20)11-9-16/h4-11,18H,1,12H2,2-3H3 |
| InChIKey | XWXHTDKBIRMNLS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|