C21H23N5O2 — CID 10150446
6-methyl-4-[[(4-methylpiperazin-1-yl)amino]methyl]pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 10150446) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 6-methyl-4-[[(4-methylpiperazin-1-yl)amino]methyl]pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 6-methyl-4-[[(4-methylpiperazin-1-yl)amino]methyl]pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 10150446 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 6-methyl-4-[[(4-methylpiperazin-1-yl)amino]methyl]pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | CN1CCN(NCc2cc3c(c4c2C(=O)NC4=O)c2ccccc2n3C)CC1 |
| InChI | InChI=1S/C21H23N5O2/c1-24-7-9-26(10-8-24)22-12-13-11-16-18(19-17(13)20(27)23-21(19)28)14-5-3-4-6-15(14)25(16)2/h3-6,11,22H,7-10,12H2,1-2H3,(H,23,27,28) |
| InChIKey | SAFWBYWFDALEIV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|