C20H29N3O5 — CID 10150649
(2S)-1-[(2S,3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-methylpiperidine-2-carboxamide (PubChem CID 10150649) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2S)-1-[(2S,3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-methylpiperidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S,3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 10150649 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (2S)-1-[(2S,3S)-3-(hydroxycarbamoyl)-2-(4-methoxyphenyl)pentanoyl]-N-methylpiperidine-2-carboxamide |
| SMILES | CC[C@H](C(=O)NO)[C@H](C(=O)N1CCCC[C@H]1C(=O)NC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-4-15(18(24)22-27)17(13-8-10-14(28-3)11-9-13)20(26)23-12-6-5-7-16(23)19(25)21-2/h8-11,15-17,27H,4-7,12H2,1-3H3,(H,21,25)(H,22,24)/t15-,16-,17+/m0/s1 |
| InChIKey | ZQORGANDVNQVJF-YESZJQIVSA-N |
| XLogP | 1.44 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|