C20H17F3N6 — CID 10150742
6-[2-[[6-methyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 10150742) has the molecular formula C20H17F3N6 and a molecular weight of 398.39 g/mol. Its IUPAC name is 6-[2-[[6-methyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[6-methyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10150742 |
| Molecular Formula | C20H17F3N6 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 6-[2-[[6-methyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(NCCNc2ccc(C#N)cn2)nc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C20H17F3N6/c1-13-10-18(26-9-8-25-17-7-6-14(11-24)12-27-17)29-19(28-13)15-4-2-3-5-16(15)20(21,22)23/h2-7,10,12H,8-9H2,1H3,(H,25,27)(H,26,28,29) |
| InChIKey | KTRTYKYAOFPASF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|