C17H13N5O3S2 — CID 10150754
N-[4-(2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide (PubChem CID 10150754) has the molecular formula C17H13N5O3S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[4-(2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide.
| Compound Name | N-[4-(2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 10150754 |
| Molecular Formula | C17H13N5O3S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[4-(2-sulfamoylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)phenyl]benzamide |
| SMILES | NS(=O)(=O)c1nn2cc(-c3ccc(NC(=O)c4ccccc4)cc3)nc2s1 |
| InChI | InChI=1S/C17H13N5O3S2/c18-27(24,25)17-21-22-10-14(20-16(22)26-17)11-6-8-13(9-7-11)19-15(23)12-4-2-1-3-5-12/h1-10H,(H,19,23)(H2,18,24,25) |
| InChIKey | HPVPQCLNKAPHKM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |