C22H24Cl2N2O — CID 10150822
(E)-1-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-N-phenylmethoxymethanimine (PubChem CID 10150822) has the molecular formula C22H24Cl2N2O and a molecular weight of 403.35 g/mol. Its IUPAC name is (E)-1-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-N-phenylmethoxymethanimine.
| Compound Name | (E)-1-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-N-phenylmethoxymethanimine |
|---|---|
| PubChem CID | 10150822 |
| Molecular Formula | C22H24Cl2N2O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (E)-1-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-N-phenylmethoxymethanimine |
| SMILES | CN1C2CC[C@@H]1[C@H](/C=N/OCc1ccccc1)[C@@H](c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C22H24Cl2N2O/c1-26-17-8-10-22(26)19(13-25-27-14-15-5-3-2-4-6-15)18(12-17)16-7-9-20(23)21(24)11-16/h2-7,9,11,13,17-19,22H,8,10,12,14H2,1H3/b25-13+/t17?,18-,19-,22-/m1/s1 |
| InChIKey | RGEMFOVSFAASRR-WXGQLFPSSA-N |
| XLogP | 5.76 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|