About 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one
2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one (PubChem CID 10150882) has the molecular formula C28H28N2O
and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one.
Molecular Properties
| Compound Name | 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one |
| PubChem CID | 10150882 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one |
| SMILES | O=c1[nH]c2ccc(CCCCN3CC=C(c4ccccc4)CC3)cc2c2ccccc12 |
| InChI | InChI=1S/C28H28N2O/c31-28-25-12-5-4-11-24(25)26-20-21(13-14-27(26)29-28)8-6-7-17-30-18-15-23(16-19-30)22-9-2-1-3-10-22/h1-5,9-15,20H,6-8,16-19H2,(H,29,31) |
| InChIKey | UBLBTRGDACYZLM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one?
The IUPAC name of 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one (CID 10150882) is 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one.
What is the SMILES notation for 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one?
The canonical SMILES for 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one is O=c1[nH]c2ccc(CCCCN3CC=C(c4ccccc4)CC3)cc2c2ccccc12.
What is the InChIKey of 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one?
The InChIKey is UBLBTRGDACYZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N2O/c31-28-25-12-5-4-11-24(25)26-20-21(13-14-27(26)29-28)8-6-7-17-30-18-15-23(16-19-30)22-9-2-1-3-10-22/h1-5,9-15,20H,6-8,16-19H2,(H,29,31).
What are the key properties of 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one?
2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one has a molecular weight of 408.55 g/mol, XLogP of 5.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]-5H-phenanthridin-6-one is sourced from PubChem (CID 10150882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).