C19H18FN7OS — CID 10150923
1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 10150923) has the molecular formula C19H18FN7OS and a molecular weight of 411.47 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 10150923 |
| Molecular Formula | C19H18FN7OS |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | Cc1cc(NNC(=O)Nc2csc(-c3ccc(F)cc3)n2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C19H18FN7OS/c1-10-8-14(21-17-16(10)11(2)26-27(17)3)24-25-19(28)23-15-9-29-18(22-15)12-4-6-13(20)7-5-12/h4-9H,1-3H3,(H,21,24)(H2,23,25,28) |
| InChIKey | QFHARHNRTPZDGU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|