C21H22FN7OS — CID 10151361
1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]urea (PubChem CID 10151361) has the molecular formula C21H22FN7OS and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]urea.
| Compound Name | 1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]urea |
|---|---|
| PubChem CID | 10151361 |
| Molecular Formula | C21H22FN7OS |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)amino]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]urea |
| SMILES | Cc1nn(C)c2nc(NNC(=O)Nc3csc(-c4ccc(F)cc4)n3)cc(C(C)C)c12 |
| InChI | InChI=1S/C21H22FN7OS/c1-11(2)15-9-16(23-19-18(15)12(3)28-29(19)4)26-27-21(30)25-17-10-31-20(24-17)13-5-7-14(22)8-6-13/h5-11H,1-4H3,(H,23,26)(H2,25,27,30) |
| InChIKey | XCPNQLBJECQTJO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|