About 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide
2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide (PubChem CID 10151402) has the molecular formula C19H18ClF2N3O3S
and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide |
| PubChem CID | 10151402 |
| Molecular Formula | C19H18ClF2N3O3S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide |
| SMILES | N#Cc1ccc(CN(C(CCC(F)F)C(N)=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClF2N3O3S/c20-15-5-7-16(8-6-15)29(27,28)25(17(19(24)26)9-10-18(21)22)12-14-3-1-13(11-23)2-4-14/h1-8,17-18H,9-10,12H2,(H2,24,26) |
| InChIKey | YHYHDJCKLMSTGV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide?
The IUPAC name of 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide (CID 10151402) is 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide.
What is the SMILES notation for 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide?
The canonical SMILES for 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide is N#Cc1ccc(CN(C(CCC(F)F)C(N)=O)S(=O)(=O)c2ccc(Cl)cc2)cc1.
What is the InChIKey of 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide?
The InChIKey is YHYHDJCKLMSTGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClF2N3O3S/c20-15-5-7-16(8-6-15)29(27,28)25(17(19(24)26)9-10-18(21)22)12-14-3-1-13(11-23)2-4-14/h1-8,17-18H,9-10,12H2,(H2,24,26).
What are the key properties of 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide?
2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide has a molecular weight of 441.89 g/mol, XLogP of 3.30, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)sulfonyl-[(4-cyanophenyl)methyl]amino]-5,5-difluoropentanamide is sourced from PubChem (CID 10151402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).