C20H18ClFN6OS — CID 10151464
1-[5-chloro-4-(4-fluorophenyl)thiophen-2-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea (PubChem CID 10151464) has the molecular formula C20H18ClFN6OS and a molecular weight of 444.92 g/mol. Its IUPAC name is 1-[5-chloro-4-(4-fluorophenyl)thiophen-2-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea.
| Compound Name | 1-[5-chloro-4-(4-fluorophenyl)thiophen-2-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
|---|---|
| PubChem CID | 10151464 |
| Molecular Formula | C20H18ClFN6OS |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 1-[5-chloro-4-(4-fluorophenyl)thiophen-2-yl]-3-[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]urea |
| SMILES | Cc1cc(NNC(=O)Nc2cc(-c3ccc(F)cc3)c(Cl)s2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C20H18ClFN6OS/c1-10-8-15(23-19-17(10)11(2)27-28(19)3)25-26-20(29)24-16-9-14(18(21)30-16)12-4-6-13(22)7-5-12/h4-9H,1-3H3,(H,23,25)(H2,24,26,29) |
| InChIKey | CRIXQYGWVQYPBA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|