About N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide
N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide (PubChem CID 10151591) has the molecular formula C24H18Cl2N2O3
and a molecular weight of 453.33 g/mol. Its IUPAC name is N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide |
| PubChem CID | 10151591 |
| Molecular Formula | C24H18Cl2N2O3 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2ccc3c(N)c(C(=O)c4ccc(Cl)cc4Cl)oc3c2)c1 |
| InChI | InChI=1S/C24H18Cl2N2O3/c1-13(29)28-12-14-3-2-4-15(9-14)16-5-7-19-21(10-16)31-24(22(19)27)23(30)18-8-6-17(25)11-20(18)26/h2-11H,12,27H2,1H3,(H,28,29) |
| InChIKey | RCZGDEIAYJLIJV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide?
The IUPAC name of N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide (CID 10151591) is N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide.
What is the SMILES notation for N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide?
The canonical SMILES for N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide is CC(=O)NCc1cccc(-c2ccc3c(N)c(C(=O)c4ccc(Cl)cc4Cl)oc3c2)c1.
What is the InChIKey of N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide?
The InChIKey is RCZGDEIAYJLIJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18Cl2N2O3/c1-13(29)28-12-14-3-2-4-15(9-14)16-5-7-19-21(10-16)31-24(22(19)27)23(30)18-8-6-17(25)11-20(18)26/h2-11H,12,27H2,1H3,(H,28,29).
What are the key properties of N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide?
N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide has a molecular weight of 453.33 g/mol, XLogP of 5.86, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[3-amino-2-(2,4-dichlorobenzoyl)-1-benzofuran-6-yl]phenyl]methyl]acetamide is sourced from PubChem (CID 10151591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).