C18H26N6O6S — CID 10151606
[(2R,3S,4R,5R)-5-[5-amino-7-(cyclopropylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 10151606) has the molecular formula C18H26N6O6S and a molecular weight of 454.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[5-amino-7-(cyclopropylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[5-amino-7-(cyclopropylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 10151606 |
| Molecular Formula | C18H26N6O6S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[5-amino-7-(cyclopropylamino)-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC[C@H]1O[C@@H](n2c(=O)sc3c(NC4CC4)nc(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H26N6O6S/c1-6(2)9(19)16(27)29-5-8-10(25)11(26)15(30-8)24-14-12(31-18(24)28)13(21-7-3-4-7)22-17(20)23-14/h6-11,15,25-26H,3-5,19H2,1-2H3,(H3,20,21,22,23)/t8-,9+,10-,11-,15-/m1/s1 |
| InChIKey | TYUCXIDFMDXFCO-HMACKLAMSA-N |
| XLogP | -0.84 |
| TPSA | 187.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |