C25H24F3N3O2 — CID 10151622
N-phenacyl-4-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]cyclohexane-1-carboxamide (PubChem CID 10151622) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is N-phenacyl-4-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]cyclohexane-1-carboxamide.
| Compound Name | N-phenacyl-4-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10151622 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-phenacyl-4-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]cyclohexane-1-carboxamide |
| SMILES | O=C(CNC(=O)C1CCC(c2ncc(-c3cccc(C(F)(F)F)c3)[nH]2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H24F3N3O2/c26-25(27,28)20-8-4-7-19(13-20)21-14-29-23(31-21)17-9-11-18(12-10-17)24(33)30-15-22(32)16-5-2-1-3-6-16/h1-8,13-14,17-18H,9-12,15H2,(H,29,31)(H,30,33) |
| InChIKey | QKXZTDTUKMDFNE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |