C17H16Cl2F2N2O5S — CID 10151858
2,2-dichloro-N-[[(5S)-3-[4-(1,1-dioxo-3,4-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 10151858) has the molecular formula C17H16Cl2F2N2O5S and a molecular weight of 469.29 g/mol. Its IUPAC name is 2,2-dichloro-N-[[(5S)-3-[4-(1,1-dioxo-3,4-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | 2,2-dichloro-N-[[(5S)-3-[4-(1,1-dioxo-3,4-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 10151858 |
| Molecular Formula | C17H16Cl2F2N2O5S |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 2,2-dichloro-N-[[(5S)-3-[4-(1,1-dioxo-3,4-dihydro-2H-thiopyran-4-yl)-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | O=C(NC[C@H]1CN(c2cc(F)c(C3C=CS(=O)(=O)CC3)c(F)c2)C(=O)O1)C(Cl)Cl |
| InChI | InChI=1S/C17H16Cl2F2N2O5S/c18-15(19)16(24)22-7-11-8-23(17(25)28-11)10-5-12(20)14(13(21)6-10)9-1-3-29(26,27)4-2-9/h1,3,5-6,9,11,15H,2,4,7-8H2,(H,22,24)/t9?,11-/m0/s1 |
| InChIKey | ARUMYESTOIUTQO-UMJHXOGRSA-N |
| XLogP | 2.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|