C25H27N7OS — CID 10151933
N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 10151933) has the molecular formula C25H27N7OS and a molecular weight of 473.61 g/mol. Its IUPAC name is N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 10151933 |
| Molecular Formula | C25H27N7OS |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[4-[[(1S,2R)-2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3cc4ccccc4s3)nc(N[C@H]3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H27N7OS/c1-14-10-11-17-16(12-14)22(28-18-7-3-4-8-19(18)29-24(26)27)31-25(30-17)32-23(33)21-13-15-6-2-5-9-20(15)34-21/h2,5-6,9-13,18-19H,3-4,7-8H2,1H3,(H4,26,27,29)(H2,28,30,31,32,33)/t18-,19?/m0/s1 |
| InChIKey | ARHFTBLZGUYWHR-OYKVQYDMSA-N |
| XLogP | 4.40 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|