About 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid
3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid (PubChem CID 10152107) has the molecular formula C26H22F2O5S
and a molecular weight of 484.52 g/mol. Its IUPAC name is 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid |
| PubChem CID | 10152107 |
| Molecular Formula | C26H22F2O5S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid |
| SMILES | CS(=O)(=O)c1ccc(OCc2ccc(F)cc2F)c(C2=C(c3cccc(C(=O)O)c3)CCC2)c1 |
| InChI | InChI=1S/C26H22F2O5S/c1-34(31,32)20-10-11-25(33-15-18-8-9-19(27)13-24(18)28)23(14-20)22-7-3-6-21(22)16-4-2-5-17(12-16)26(29)30/h2,4-5,8-14H,3,6-7,15H2,1H3,(H,29,30) |
| InChIKey | JFVQDLPHYADOEB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid?
The IUPAC name of 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid (CID 10152107) is 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid.
What is the SMILES notation for 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid?
The canonical SMILES for 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid is CS(=O)(=O)c1ccc(OCc2ccc(F)cc2F)c(C2=C(c3cccc(C(=O)O)c3)CCC2)c1.
What is the InChIKey of 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid?
The InChIKey is JFVQDLPHYADOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22F2O5S/c1-34(31,32)20-10-11-25(33-15-18-8-9-19(27)13-24(18)28)23(14-20)22-7-3-6-21(22)16-4-2-5-17(12-16)26(29)30/h2,4-5,8-14H,3,6-7,15H2,1H3,(H,29,30).
What are the key properties of 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid?
3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid has a molecular weight of 484.52 g/mol, XLogP of 5.74, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-[(2,4-difluorophenyl)methoxy]-5-methylsulfonylphenyl]cyclopenten-1-yl]benzoic acid is sourced from PubChem (CID 10152107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).