C32H31FN6O — CID 10152770
2-[3-[4-[1-(4-fluorophenyl)-5-(1-methyl-1,2,4-triazol-3-yl)indol-3-yl]piperidin-1-yl]propoxy]benzonitrile (PubChem CID 10152770) has the molecular formula C32H31FN6O and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[3-[4-[1-(4-fluorophenyl)-5-(1-methyl-1,2,4-triazol-3-yl)indol-3-yl]piperidin-1-yl]propoxy]benzonitrile.
| Compound Name | 2-[3-[4-[1-(4-fluorophenyl)-5-(1-methyl-1,2,4-triazol-3-yl)indol-3-yl]piperidin-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 10152770 |
| Molecular Formula | C32H31FN6O |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 2-[3-[4-[1-(4-fluorophenyl)-5-(1-methyl-1,2,4-triazol-3-yl)indol-3-yl]piperidin-1-yl]propoxy]benzonitrile |
| SMILES | Cn1cnc(-c2ccc3c(c2)c(C2CCN(CCCOc4ccccc4C#N)CC2)cn3-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C32H31FN6O/c1-37-22-35-32(36-37)24-7-12-30-28(19-24)29(21-39(30)27-10-8-26(33)9-11-27)23-13-16-38(17-14-23)15-4-18-40-31-6-3-2-5-25(31)20-34/h2-3,5-12,19,21-23H,4,13-18H2,1H3 |
| InChIKey | MXHIBUNGJJDWHZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|