C33H31ClF6N2O — CID 10153354
3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 10153354) has the molecular formula C33H31ClF6N2O and a molecular weight of 621.07 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 10153354 |
| Molecular Formula | C33H31ClF6N2O |
| Molecular Weight | 621.07 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | FC(F)(F)CNc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H31ClF6N2O/c34-31-26(14-7-17-30(31)33(38,39)40)21-42(22-29(24-10-3-1-4-11-24)25-12-5-2-6-13-25)18-9-19-43-28-16-8-15-27(20-28)41-23-32(35,36)37/h1-8,10-17,20,29,41H,9,18-19,21-23H2 |
| InChIKey | WWIXCXAFKRBLDD-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.07 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|