C17H13BrF5N — CID 101534296
1-(2-bromophenyl)-N-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine (PubChem CID 101534296) has the molecular formula C17H13BrF5N and a molecular weight of 406.20 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine.
| Compound Name | 1-(2-bromophenyl)-N-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|---|
| PubChem CID | 101534296 |
| Molecular Formula | C17H13BrF5N |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 1-(2-bromophenyl)-N-tert-butyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
| SMILES | CC(C)(C)N=C(C1=CC=CC=C1Br)C2=C(C(=C(C(=C2F)F)F)F)F |
| InChI | InChI=1S/C17H13BrF5N/c1-17(2,3)24-16(8-6-4-5-7-9(8)18)10-11(19)13(21)15(23)14(22)12(10)20/h4-7H,1-3H3 |
| InChIKey | GVCTWSJFFCVJFX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 450 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|