C37H34ClF3N2O3 — CID 10153440
N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-methylfuran-2-carboxamide (PubChem CID 10153440) has the molecular formula C37H34ClF3N2O3 and a molecular weight of 647.14 g/mol. Its IUPAC name is N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 10153440 |
| Molecular Formula | C37H34ClF3N2O3 |
| Molecular Weight | 647.14 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(C(=O)c1ccco1)c1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H34ClF3N2O3/c1-42(36(44)34-20-10-22-46-34)30-17-9-18-31(24-30)45-23-11-21-43(25-29-16-8-19-33(35(29)38)37(39,40)41)26-32(27-12-4-2-5-13-27)28-14-6-3-7-15-28/h2-10,12-20,22,24,32H,11,21,23,25-26H2,1H3 |
| InChIKey | KDRZFIMCHQPUOZ-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.14 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|