About 2-hydroperoxybutane
2-hydroperoxybutane (PubChem CID 10154001) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is 2-hydroperoxybutane.
Molecular Properties
| Compound Name | 2-hydroperoxybutane |
| PubChem CID | 10154001 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | 2-hydroperoxybutane |
| SMILES | CCC(C)OO |
| InChI | InChI=1S/C4H10O2/c1-3-4(2)6-5/h4-5H,3H2,1-2H3 |
| InChIKey | SPQMVUPFYWDFCB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxybutane?
The IUPAC name of 2-hydroperoxybutane (CID 10154001) is 2-hydroperoxybutane.
What is the SMILES notation for 2-hydroperoxybutane?
The canonical SMILES for 2-hydroperoxybutane is CCC(C)OO.
What is the InChIKey of 2-hydroperoxybutane?
The InChIKey is SPQMVUPFYWDFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2/c1-3-4(2)6-5/h4-5H,3H2,1-2H3.
What are the key properties of 2-hydroperoxybutane?
2-hydroperoxybutane has a molecular weight of 90.12 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxybutane is sourced from PubChem (CID 10154001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).