1-methylpyrrole-3-carboxylic acid

C6H7NO2 — CID 10154054

IUPAC1-methylpyrrole-3-carboxylic acid
SMILESCn1ccc(C(=O)O)c1
InChIInChI=1S/C6H7NO2/c1-7-3-2-5(4-7)6(8)9/h2-4H,1H3,(H,8,9)
InChIKeyOONDRKVHFCQDCG-UHFFFAOYSA-N
MW125.13 g/mol
LogP0.72
Rot. Bonds1

About 1-methylpyrrole-3-carboxylic acid

1-methylpyrrole-3-carboxylic acid (PubChem CID 10154054) has the molecular formula C6H7NO2 and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-methylpyrrole-3-carboxylic acid.

Molecular Properties

Compound Name1-methylpyrrole-3-carboxylic acid
PubChem CID10154054
Molecular FormulaC6H7NO2
Molecular Weight125.13 g/mol
Exact Mass125.05
IUPAC Name1-methylpyrrole-3-carboxylic acid
SMILESCn1ccc(C(=O)O)c1
InChIInChI=1S/C6H7NO2/c1-7-3-2-5(4-7)6(8)9/h2-4H,1H3,(H,8,9)
InChIKeyOONDRKVHFCQDCG-UHFFFAOYSA-N
XLogP0.72
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500125.13
LogP ≤ 50.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-methylpyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylpyrrole-3-carboxylic acid?
The IUPAC name of 1-methylpyrrole-3-carboxylic acid (CID 10154054) is 1-methylpyrrole-3-carboxylic acid.
What is the SMILES notation for 1-methylpyrrole-3-carboxylic acid?
The canonical SMILES for 1-methylpyrrole-3-carboxylic acid is Cn1ccc(C(=O)O)c1.
What is the InChIKey of 1-methylpyrrole-3-carboxylic acid?
The InChIKey is OONDRKVHFCQDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c1-7-3-2-5(4-7)6(8)9/h2-4H,1H3,(H,8,9).
What are the key properties of 1-methylpyrrole-3-carboxylic acid?
1-methylpyrrole-3-carboxylic acid has a molecular weight of 125.13 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrole-3-carboxylic acid is sourced from PubChem (CID 10154054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).