About 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one
2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one (PubChem CID 10154117) has the molecular formula C4H7N3OS
and a molecular weight of 145.19 g/mol. Its IUPAC name is 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one |
| PubChem CID | 10154117 |
| Molecular Formula | C4H7N3OS |
| Molecular Weight | 145.19 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one |
| SMILES | NC1=NC(CS)C(=O)N1 |
| InChI | InChI=1S/C4H7N3OS/c5-4-6-2(1-9)3(8)7-4/h2,9H,1H2,(H3,5,6,7,8) |
| InChIKey | JTHQOEQNCCWDTH-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.19 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one (CID 10154117) is 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one is NC1=NC(CS)C(=O)N1.
What is the InChIKey of 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one?
The InChIKey is JTHQOEQNCCWDTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3OS/c5-4-6-2(1-9)3(8)7-4/h2,9H,1H2,(H3,5,6,7,8).
What are the key properties of 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one?
2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one has a molecular weight of 145.19 g/mol, XLogP of -1.27, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(sulfanylmethyl)-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 10154117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).