About (2-chloro-1,3-thiazol-5-yl)methanamine
(2-chloro-1,3-thiazol-5-yl)methanamine (PubChem CID 10154129) has the molecular formula C4H5ClN2S
and a molecular weight of 148.62 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-5-yl)methanamine |
| PubChem CID | 10154129 |
| Molecular Formula | C4H5ClN2S |
| Molecular Weight | 148.62 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | (2-chloro-1,3-thiazol-5-yl)methanamine |
| SMILES | NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C4H5ClN2S/c5-4-7-2-3(1-6)8-4/h2H,1,6H2 |
| InChIKey | KCDQBIMJBRASQE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.62 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chloro-1,3-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-5-yl)methanamine?
The IUPAC name of (2-chloro-1,3-thiazol-5-yl)methanamine (CID 10154129) is (2-chloro-1,3-thiazol-5-yl)methanamine.
What is the SMILES notation for (2-chloro-1,3-thiazol-5-yl)methanamine?
The canonical SMILES for (2-chloro-1,3-thiazol-5-yl)methanamine is NCc1cnc(Cl)s1.
What is the InChIKey of (2-chloro-1,3-thiazol-5-yl)methanamine?
The InChIKey is KCDQBIMJBRASQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2S/c5-4-7-2-3(1-6)8-4/h2H,1,6H2.
What are the key properties of (2-chloro-1,3-thiazol-5-yl)methanamine?
(2-chloro-1,3-thiazol-5-yl)methanamine has a molecular weight of 148.62 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-5-yl)methanamine is sourced from PubChem (CID 10154129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).