About (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol
(1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol (PubChem CID 10154140) has the molecular formula C9H9FO
and a molecular weight of 152.17 g/mol. Its IUPAC name is (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 10154140 |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@@H]1Cc2ccccc2[C@H]1F |
| InChI | InChI=1S/C9H9FO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5H2/t8-,9-/m1/s1 |
| InChIKey | OOIUGIJAUUXMTA-RKDXNWHRSA-N |
| XLogP | 1.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol (CID 10154140) is (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol is O[C@@H]1Cc2ccccc2[C@H]1F.
What is the InChIKey of (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol?
The InChIKey is OOIUGIJAUUXMTA-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H9FO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5H2/t8-,9-/m1/s1.
What are the key properties of (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol?
(1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol has a molecular weight of 152.17 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-1-fluoro-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 10154140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).