C9H12N2O — CID 10154206
1-methyl-2,3,4,6-tetrahydro-1,6-naphthyridin-5-one (PubChem CID 10154206) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-methyl-2,3,4,6-tetrahydro-1,6-naphthyridin-5-one.
| Compound Name | 1-methyl-2,3,4,6-tetrahydro-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 10154206 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-methyl-2,3,4,6-tetrahydro-1,6-naphthyridin-5-one |
| SMILES | CN1CCCc2c1cc[nH]c2=O |
| InChI | InChI=1S/C9H12N2O/c1-11-6-2-3-7-8(11)4-5-10-9(7)12/h4-5H,2-3,6H2,1H3,(H,10,12) |
| InChIKey | IAMHWVMYXOLZSG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |