C20H15ClN4 — CID 10154692
2-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)quinazolin-4-amine (PubChem CID 10154692) has the molecular formula C20H15ClN4 and a molecular weight of 346.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)quinazolin-4-amine.
| Compound Name | 2-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 10154692 |
| Molecular Formula | C20H15ClN4 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(pyridin-4-ylmethyl)quinazolin-4-amine |
| SMILES | Clc1ccc(-c2nc(NCc3ccncc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H15ClN4/c21-16-7-5-15(6-8-16)19-24-18-4-2-1-3-17(18)20(25-19)23-13-14-9-11-22-12-10-14/h1-12H,13H2,(H,23,24,25) |
| InChIKey | BSQSLGIPIKNVSA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |