About 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole
5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole (PubChem CID 10154767) has the molecular formula C22H18F2N2
and a molecular weight of 348.40 g/mol. Its IUPAC name is 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole.
Molecular Properties
| Compound Name | 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole |
| PubChem CID | 10154767 |
| Molecular Formula | C22H18F2N2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole |
| SMILES | Cc1cccc(C2=NCC(c3ccc(F)cc3)(c3ccc(F)cc3)N2)c1 |
| InChI | InChI=1S/C22H18F2N2/c1-15-3-2-4-16(13-15)21-25-14-22(26-21,17-5-9-19(23)10-6-17)18-7-11-20(24)12-8-18/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | LZSXXSURRNAUSS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole?
The IUPAC name of 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole (CID 10154767) is 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole.
What is the SMILES notation for 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole?
The canonical SMILES for 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole is Cc1cccc(C2=NCC(c3ccc(F)cc3)(c3ccc(F)cc3)N2)c1.
What is the InChIKey of 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole?
The InChIKey is LZSXXSURRNAUSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F2N2/c1-15-3-2-4-16(13-15)21-25-14-22(26-21,17-5-9-19(23)10-6-17)18-7-11-20(24)12-8-18/h2-13H,14H2,1H3,(H,25,26).
What are the key properties of 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole?
5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole has a molecular weight of 348.40 g/mol, XLogP of 4.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(4-fluorophenyl)-2-(3-methylphenyl)-1,4-dihydroimidazole is sourced from PubChem (CID 10154767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).