About 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide
2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide (PubChem CID 10154985) has the molecular formula C17H26BrN3
and a molecular weight of 352.32 g/mol. Its IUPAC name is 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide.
Molecular Properties
| Compound Name | 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide |
| PubChem CID | 10154985 |
| Molecular Formula | C17H26BrN3 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide |
| SMILES | N#CC[n+]1cc(C2CCCCC2)n(C2CCCCC2)c1.[Br-] |
| InChI | InChI=1S/C17H26N3.BrH/c18-11-12-19-13-17(15-7-3-1-4-8-15)20(14-19)16-9-5-2-6-10-16;/h13-16H,1-10,12H2;1H/q+1;/p-1 |
| InChIKey | GZQIZDWOQJGUCT-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide?
The IUPAC name of 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide (CID 10154985) is 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide.
What is the SMILES notation for 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide?
The canonical SMILES for 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide is N#CC[n+]1cc(C2CCCCC2)n(C2CCCCC2)c1.[Br-].
What is the InChIKey of 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide?
The InChIKey is GZQIZDWOQJGUCT-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H26N3.BrH/c18-11-12-19-13-17(15-7-3-1-4-8-15)20(14-19)16-9-5-2-6-10-16;/h13-16H,1-10,12H2;1H/q+1;/p-1.
What are the key properties of 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide?
2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide has a molecular weight of 352.32 g/mol, XLogP of 0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dicyclohexylimidazol-1-ium-1-yl)acetonitrile bromide is sourced from PubChem (CID 10154985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).