C22H32N4 — CID 10155006
N-ethyl-2-methyl-N-propyl-8-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-amine (PubChem CID 10155006) has the molecular formula C22H32N4 and a molecular weight of 352.53 g/mol. Its IUPAC name is N-ethyl-2-methyl-N-propyl-8-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | N-ethyl-2-methyl-N-propyl-8-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 10155006 |
| Molecular Formula | C22H32N4 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | N-ethyl-2-methyl-N-propyl-8-(2,4,6-trimethylphenyl)-5,6,7,8-tetrahydropyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CCCN(CC)c1nc(C)nc2c1NCCC2c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H32N4/c1-7-11-26(8-2)22-21-20(24-17(6)25-22)18(9-10-23-21)19-15(4)12-14(3)13-16(19)5/h12-13,18,23H,7-11H2,1-6H3 |
| InChIKey | OFAPFNDBNJMTFG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |