C14H12F6N2O2 — CID 10155073
2-[4-(5-amino-3-ethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10155073) has the molecular formula C14H12F6N2O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 2-[4-(5-amino-3-ethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(5-amino-3-ethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10155073 |
| Molecular Formula | C14H12F6N2O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-[4-(5-amino-3-ethyl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCc1noc(N)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F6N2O2/c1-2-9-10(11(21)24-22-9)7-3-5-8(6-4-7)12(23,13(15,16)17)14(18,19)20/h3-6,23H,2,21H2,1H3 |
| InChIKey | ZXSQHTDULMSNMS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |