C11H10ClNO2 — CID 101550840
[5-(Chloromethyl)-4,5-dihydro-1,2-oxazol-3-yl]-phenylmethanone (PubChem CID 101550840) has the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. Its IUPAC name is [5-(chloromethyl)-4,5-dihydro-1,2-oxazol-3-yl]-phenylmethanone.
| Compound Name | [5-(Chloromethyl)-4,5-dihydro-1,2-oxazol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101550840 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.65 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | [5-(chloromethyl)-4,5-dihydro-1,2-oxazol-3-yl]-phenylmethanone |
| SMILES | C1C(ON=C1C(=O)C2=CC=CC=C2)CCl |
| InChI | InChI=1S/C11H10ClNO2/c12-7-9-6-10(13-15-9)11(14)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | XOMDAQHOTVQFOP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | 272 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|