About 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine
9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine (PubChem CID 10155127) has the molecular formula C13H12F3N7O2
and a molecular weight of 355.28 g/mol. Its IUPAC name is 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine.
Molecular Properties
| Compound Name | 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine |
| PubChem CID | 10155127 |
| Molecular Formula | C13H12F3N7O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine |
| SMILES | CNc1nc(C(F)(F)F)nc2c1ncn2-c1cnc(OC)nc1OC |
| InChI | InChI=1S/C13H12F3N7O2/c1-17-8-7-9(21-11(20-8)13(14,15)16)23(5-19-7)6-4-18-12(25-3)22-10(6)24-2/h4-5H,1-3H3,(H,17,20,21) |
| InChIKey | YHSICINPSDWJLY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine?
The IUPAC name of 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine (CID 10155127) is 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine.
What is the SMILES notation for 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine?
The canonical SMILES for 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine is CNc1nc(C(F)(F)F)nc2c1ncn2-c1cnc(OC)nc1OC.
What is the InChIKey of 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine?
The InChIKey is YHSICINPSDWJLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N7O2/c1-17-8-7-9(21-11(20-8)13(14,15)16)23(5-19-7)6-4-18-12(25-3)22-10(6)24-2/h4-5H,1-3H3,(H,17,20,21).
What are the key properties of 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine?
9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine has a molecular weight of 355.28 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,4-dimethoxypyrimidin-5-yl)-N-methyl-2-(trifluoromethyl)purin-6-amine is sourced from PubChem (CID 10155127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).