C14H11Cl4NO3 — CID 1015545
2-[bis(prop-2-enyl)carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 1015545) has the molecular formula C14H11Cl4NO3 and a molecular weight of 383.06 g/mol. Its IUPAC name is 2-[bis(prop-2-enyl)carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[bis(prop-2-enyl)carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 1015545 |
| Molecular Formula | C14H11Cl4NO3 |
| Molecular Weight | 383.06 g/mol |
| Exact Mass | 380.95 |
| IUPAC Name | 2-[bis(prop-2-enyl)carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | C=CCN(CC=C)C(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C14H11Cl4NO3/c1-3-5-19(6-4-2)13(20)7-8(14(21)22)10(16)12(18)11(17)9(7)15/h3-4H,1-2,5-6H2,(H,21,22) |
| InChIKey | WDPJROPOSNKZOQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.06 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|