About 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline
8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline (PubChem CID 10155643) has the molecular formula C19H22ClNO4
and a molecular weight of 363.84 g/mol. Its IUPAC name is 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline.
Molecular Properties
| Compound Name | 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline |
| PubChem CID | 10155643 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline |
| SMILES | CCOCCCC#Cc1c(OC)nc2c(Cl)c(OC)ccc2c1OC |
| InChI | InChI=1S/C19H22ClNO4/c1-5-25-12-8-6-7-9-14-18(23-3)13-10-11-15(22-2)16(20)17(13)21-19(14)24-4/h10-11H,5-6,8,12H2,1-4H3 |
| InChIKey | LDNQKPMKOIBVJV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline?
The IUPAC name of 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline (CID 10155643) is 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline.
What is the SMILES notation for 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline?
The canonical SMILES for 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline is CCOCCCC#Cc1c(OC)nc2c(Cl)c(OC)ccc2c1OC.
What is the InChIKey of 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline?
The InChIKey is LDNQKPMKOIBVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClNO4/c1-5-25-12-8-6-7-9-14-18(23-3)13-10-11-15(22-2)16(20)17(13)21-19(14)24-4/h10-11H,5-6,8,12H2,1-4H3.
What are the key properties of 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline?
8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline has a molecular weight of 363.84 g/mol, XLogP of 4.08, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-(5-ethoxypent-1-ynyl)-2,4,7-trimethoxyquinoline is sourced from PubChem (CID 10155643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).