About (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate
(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate (PubChem CID 10155679) has the molecular formula C22H24N2O3
and a molecular weight of 364.44 g/mol. Its IUPAC name is (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate.
Molecular Properties
| Compound Name | (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate |
| PubChem CID | 10155679 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate |
| SMILES | NC(=O)N1c2ccccc2CC(OC(=O)C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c23-22(26)24-18-12-6-4-10-16(18)14-20(17-11-5-7-13-19(17)24)27-21(25)15-8-2-1-3-9-15/h4-7,10-13,15,20H,1-3,8-9,14H2,(H2,23,26) |
| InChIKey | BAGHAQWYMWAJHW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate?
The IUPAC name of (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate (CID 10155679) is (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate.
What is the SMILES notation for (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate?
The canonical SMILES for (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate is NC(=O)N1c2ccccc2CC(OC(=O)C2CCCCC2)c2ccccc21.
What is the InChIKey of (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate?
The InChIKey is BAGHAQWYMWAJHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3/c23-22(26)24-18-12-6-4-10-16(18)14-20(17-11-5-7-13-19(17)24)27-21(25)15-8-2-1-3-9-15/h4-7,10-13,15,20H,1-3,8-9,14H2,(H2,23,26).
What are the key properties of (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate?
(11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate has a molecular weight of 364.44 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (11-carbamoyl-5,6-dihydrobenzo[b][1]benzazepin-5-yl) cyclohexanecarboxylate is sourced from PubChem (CID 10155679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).