C21H23N3OS — CID 10155745
6-methyl-N-(4-methylphenyl)-4-(2-phenylethyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 10155745) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 6-methyl-N-(4-methylphenyl)-4-(2-phenylethyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-methyl-N-(4-methylphenyl)-4-(2-phenylethyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10155745 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 6-methyl-N-(4-methylphenyl)-4-(2-phenylethyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2)C(CCc2ccccc2)NC(=S)N1 |
| InChI | InChI=1S/C21H23N3OS/c1-14-8-11-17(12-9-14)23-20(25)19-15(2)22-21(26)24-18(19)13-10-16-6-4-3-5-7-16/h3-9,11-12,18H,10,13H2,1-2H3,(H,23,25)(H2,22,24,26) |
| InChIKey | MLPGDOIADIIFJU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|