C16H26N6O4 — CID 10155781
(2R,3R,4S,5R)-2-[6-[5-aminopentyl(methyl)amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10155781) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[5-aminopentyl(methyl)amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[5-aminopentyl(methyl)amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10155781 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[5-aminopentyl(methyl)amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CN(CCCCCN)c1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H26N6O4/c1-21(6-4-2-3-5-17)14-11-15(19-8-18-14)22(9-20-11)16-13(25)12(24)10(7-23)26-16/h8-10,12-13,16,23-25H,2-7,17H2,1H3/t10-,12-,13-,16-/m1/s1 |
| InChIKey | XRPNLYTWEQPRHR-XNIJJKJLSA-N |
| XLogP | -1.00 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|