C20H40N4S — CID 10155913
3-N-decyl-5-N,5-N-bis(2-methylpropyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 10155913) has the molecular formula C20H40N4S and a molecular weight of 368.64 g/mol. Its IUPAC name is 3-N-decyl-5-N,5-N-bis(2-methylpropyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 3-N-decyl-5-N,5-N-bis(2-methylpropyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 10155913 |
| Molecular Formula | C20H40N4S |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | 3-N-decyl-5-N,5-N-bis(2-methylpropyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCCCCCCCCCNc1nsc(N(CC(C)C)CC(C)C)n1 |
| InChI | InChI=1S/C20H40N4S/c1-6-7-8-9-10-11-12-13-14-21-19-22-20(25-23-19)24(15-17(2)3)16-18(4)5/h17-18H,6-16H2,1-5H3,(H,21,23) |
| InChIKey | BRICDMIYRXIEMO-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|